C19H24FN3O3 — CID 46657081
methyl 6-[[1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-carbonyl]amino]hexanoate (PubChem CID 46657081) has the molecular formula C19H24FN3O3 and a molecular weight of 361.42 g/mol. Its IUPAC name is methyl 6-[[1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-carbonyl]amino]hexanoate.
| Compound Name | methyl 6-[[1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-carbonyl]amino]hexanoate |
|---|---|
| PubChem CID | 46657081 |
| Molecular Formula | C19H24FN3O3 |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | methyl 6-[[1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-carbonyl]amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)c1c(C)nn(-c2ccc(F)cc2)c1C |
| InChI | InChI=1S/C19H24FN3O3/c1-13-18(19(25)21-12-6-4-5-7-17(24)26-3)14(2)23(22-13)16-10-8-15(20)9-11-16/h8-11H,4-7,12H2,1-3H3,(H,21,25) |
| InChIKey | VZBSGGXBJPQHGR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|