C15H20ClFN4O — CID 119502383
1-(4-fluorophenyl)-3,5-dimethyl-N-[2-(methylamino)ethyl]pyrazole-4-carboxamide;hydrochloride (PubChem CID 119502383) has the molecular formula C15H20ClFN4O and a molecular weight of 326.80 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3,5-dimethyl-N-[2-(methylamino)ethyl]pyrazole-4-carboxamide;hydrochloride.
| Compound Name | 1-(4-fluorophenyl)-3,5-dimethyl-N-[2-(methylamino)ethyl]pyrazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119502383 |
| Molecular Formula | C15H20ClFN4O |
| Molecular Weight | 326.80 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 1-(4-fluorophenyl)-3,5-dimethyl-N-[2-(methylamino)ethyl]pyrazole-4-carboxamide;hydrochloride |
| SMILES | CNCCNC(=O)c1c(C)nn(-c2ccc(F)cc2)c1C.Cl |
| InChI | InChI=1S/C15H19FN4O.ClH/c1-10-14(15(21)18-9-8-17-3)11(2)20(19-10)13-6-4-12(16)5-7-13;/h4-7,17H,8-9H2,1-3H3,(H,18,21);1H |
| InChIKey | SUHNMFDAAFIMFG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.80 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|