C16H22ClFN4O — CID 119507312
N-[2-(ethylamino)ethyl]-1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-carboxamide;hydrochloride (PubChem CID 119507312) has the molecular formula C16H22ClFN4O and a molecular weight of 340.83 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-carboxamide;hydrochloride.
| Compound Name | N-[2-(ethylamino)ethyl]-1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119507312 |
| Molecular Formula | C16H22ClFN4O |
| Molecular Weight | 340.83 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-carboxamide;hydrochloride |
| SMILES | CCNCCNC(=O)c1c(C)nn(-c2ccc(F)cc2)c1C.Cl |
| InChI | InChI=1S/C16H21FN4O.ClH/c1-4-18-9-10-19-16(22)15-11(2)20-21(12(15)3)14-7-5-13(17)6-8-14;/h5-8,18H,4,9-10H2,1-3H3,(H,19,22);1H |
| InChIKey | IFYRXVPSFALVSG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.83 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|