C14H17N3OS — CID 13170727
3,5-dimethyl-1-phenyl-N-(2-sulfanylethyl)pyrazole-4-carboxamide (PubChem CID 13170727) has the molecular formula C14H17N3OS and a molecular weight of 275.38 g/mol. Its IUPAC name is 3,5-dimethyl-1-phenyl-N-(2-sulfanylethyl)pyrazole-4-carboxamide.
| Compound Name | 3,5-dimethyl-1-phenyl-N-(2-sulfanylethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 13170727 |
| Molecular Formula | C14H17N3OS |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 3,5-dimethyl-1-phenyl-N-(2-sulfanylethyl)pyrazole-4-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(=O)NCCS |
| InChI | InChI=1S/C14H17N3OS/c1-10-13(14(18)15-8-9-19)11(2)17(16-10)12-6-4-3-5-7-12/h3-7,19H,8-9H2,1-2H3,(H,15,18) |
| InChIKey | OIMWIFBVUDRKSL-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|