C18H25N3O — CID 33076349
3,5-dimethyl-N-(4-methylpentyl)-1-phenylpyrazole-4-carboxamide (PubChem CID 33076349) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is 3,5-dimethyl-N-(4-methylpentyl)-1-phenylpyrazole-4-carboxamide.
| Compound Name | 3,5-dimethyl-N-(4-methylpentyl)-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 33076349 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 3,5-dimethyl-N-(4-methylpentyl)-1-phenylpyrazole-4-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(=O)NCCCC(C)C |
| InChI | InChI=1S/C18H25N3O/c1-13(2)9-8-12-19-18(22)17-14(3)20-21(15(17)4)16-10-6-5-7-11-16/h5-7,10-11,13H,8-9,12H2,1-4H3,(H,19,22) |
| InChIKey | RDRVYUMCHUBHPE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|