C19H26ClN3O — CID 2569570
5-chloro-3-methyl-N-[(2S)-6-methylheptan-2-yl]-1-phenylpyrazole-4-carboxamide (PubChem CID 2569570) has the molecular formula C19H26ClN3O and a molecular weight of 347.89 g/mol. Its IUPAC name is 5-chloro-3-methyl-N-[(2S)-6-methylheptan-2-yl]-1-phenylpyrazole-4-carboxamide.
| Compound Name | 5-chloro-3-methyl-N-[(2S)-6-methylheptan-2-yl]-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 2569570 |
| Molecular Formula | C19H26ClN3O |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 5-chloro-3-methyl-N-[(2S)-6-methylheptan-2-yl]-1-phenylpyrazole-4-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1C(=O)N[C@@H](C)CCCC(C)C |
| InChI | InChI=1S/C19H26ClN3O/c1-13(2)9-8-10-14(3)21-19(24)17-15(4)22-23(18(17)20)16-11-6-5-7-12-16/h5-7,11-14H,8-10H2,1-4H3,(H,21,24)/t14-/m0/s1 |
| InChIKey | OWGOJWGYZXCZMV-AWEZNQCLSA-N |
| XLogP | 4.78 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |