C14H14ClN3O3 — CID 91645010
(2R)-2-[(5-chloro-3-methyl-1-phenylpyrazole-4-carbonyl)amino]propanoic acid (PubChem CID 91645010) has the molecular formula C14H14ClN3O3 and a molecular weight of 307.74 g/mol. Its IUPAC name is (2R)-2-[(5-chloro-3-methyl-1-phenylpyrazole-4-carbonyl)amino]propanoic acid.
| Compound Name | (2R)-2-[(5-chloro-3-methyl-1-phenylpyrazole-4-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 91645010 |
| Molecular Formula | C14H14ClN3O3 |
| Molecular Weight | 307.74 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | (2R)-2-[(5-chloro-3-methyl-1-phenylpyrazole-4-carbonyl)amino]propanoic acid |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1C(=O)N[C@H](C)C(=O)O |
| InChI | InChI=1S/C14H14ClN3O3/c1-8-11(13(19)16-9(2)14(20)21)12(15)18(17-8)10-6-4-3-5-7-10/h3-7,9H,1-2H3,(H,16,19)(H,20,21)/t9-/m1/s1 |
| InChIKey | WLAWJYOIISCSAZ-SECBINFHSA-N |
| XLogP | 2.04 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.74 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |