C21H22ClN3O — CID 26102988
N-(4-tert-butylphenyl)-5-chloro-3-methyl-1-phenylpyrazole-4-carboxamide (PubChem CID 26102988) has the molecular formula C21H22ClN3O and a molecular weight of 367.88 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-5-chloro-3-methyl-1-phenylpyrazole-4-carboxamide.
| Compound Name | N-(4-tert-butylphenyl)-5-chloro-3-methyl-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 26102988 |
| Molecular Formula | C21H22ClN3O |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | N-(4-tert-butylphenyl)-5-chloro-3-methyl-1-phenylpyrazole-4-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1C(=O)Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H22ClN3O/c1-14-18(19(22)25(24-14)17-8-6-5-7-9-17)20(26)23-16-12-10-15(11-13-16)21(2,3)4/h5-13H,1-4H3,(H,23,26) |
| InChIKey | ANIYBEVDNSZVJJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |