C19H18ClN3O3S — CID 60605483
5-chloro-3-methyl-N-[3-(methylsulfonylmethyl)phenyl]-1-phenylpyrazole-4-carboxamide (PubChem CID 60605483) has the molecular formula C19H18ClN3O3S and a molecular weight of 403.89 g/mol. Its IUPAC name is 5-chloro-3-methyl-N-[3-(methylsulfonylmethyl)phenyl]-1-phenylpyrazole-4-carboxamide.
| Compound Name | 5-chloro-3-methyl-N-[3-(methylsulfonylmethyl)phenyl]-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 60605483 |
| Molecular Formula | C19H18ClN3O3S |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 5-chloro-3-methyl-N-[3-(methylsulfonylmethyl)phenyl]-1-phenylpyrazole-4-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1C(=O)Nc1cccc(CS(C)(=O)=O)c1 |
| InChI | InChI=1S/C19H18ClN3O3S/c1-13-17(18(20)23(22-13)16-9-4-3-5-10-16)19(24)21-15-8-6-7-14(11-15)12-27(2,25)26/h3-11H,12H2,1-2H3,(H,21,24) |
| InChIKey | ZZYBJPNKIYNGIM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |