C22H17ClN4O2S — CID 46603289
5-chloro-3-methyl-1-phenyl-N-[3-(thiophene-2-carbonylamino)phenyl]pyrazole-4-carboxamide (PubChem CID 46603289) has the molecular formula C22H17ClN4O2S and a molecular weight of 436.92 g/mol. Its IUPAC name is 5-chloro-3-methyl-1-phenyl-N-[3-(thiophene-2-carbonylamino)phenyl]pyrazole-4-carboxamide.
| Compound Name | 5-chloro-3-methyl-1-phenyl-N-[3-(thiophene-2-carbonylamino)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 46603289 |
| Molecular Formula | C22H17ClN4O2S |
| Molecular Weight | 436.92 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | 5-chloro-3-methyl-1-phenyl-N-[3-(thiophene-2-carbonylamino)phenyl]pyrazole-4-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1C(=O)Nc1cccc(NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C22H17ClN4O2S/c1-14-19(20(23)27(26-14)17-9-3-2-4-10-17)22(29)25-16-8-5-7-15(13-16)24-21(28)18-11-6-12-30-18/h2-13H,1H3,(H,24,28)(H,25,29) |
| InChIKey | VDHPBCBIMOXYDX-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.92 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |