C21H31N4O+ — CID 9473008
3,5-dimethyl-N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]-1-phenylpyrazole-4-carboxamide (PubChem CID 9473008) has the molecular formula C21H31N4O+ and a molecular weight of 355.51 g/mol. Its IUPAC name is 3,5-dimethyl-N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]-1-phenylpyrazole-4-carboxamide.
| Compound Name | 3,5-dimethyl-N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 9473008 |
| Molecular Formula | C21H31N4O+ |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | 3,5-dimethyl-N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]-1-phenylpyrazole-4-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(=O)NCCC[NH+]1CCCC[C@@H]1C |
| InChI | InChI=1S/C21H30N4O/c1-16-10-7-8-14-24(16)15-9-13-22-21(26)20-17(2)23-25(18(20)3)19-11-5-4-6-12-19/h4-6,11-12,16H,7-10,13-15H2,1-3H3,(H,22,26)/p+1/t16-/m0/s1 |
| InChIKey | IQRWFETUKAIWKT-INIZCTEOSA-O |
| XLogP | 2.07 |
| TPSA | 51.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|