C25H30FN4O+ — CID 7414581
3-(4-fluorophenyl)-N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]-1-phenylpyrazole-5-carboxamide (PubChem CID 7414581) has the molecular formula C25H30FN4O+ and a molecular weight of 421.54 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]-1-phenylpyrazole-5-carboxamide.
| Compound Name | 3-(4-fluorophenyl)-N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]-1-phenylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 7414581 |
| Molecular Formula | C25H30FN4O+ |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]-1-phenylpyrazole-5-carboxamide |
| SMILES | C[C@H]1CCCC[NH+]1CCCNC(=O)c1cc(-c2ccc(F)cc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C25H29FN4O/c1-19-8-5-6-16-29(19)17-7-15-27-25(31)24-18-23(20-11-13-21(26)14-12-20)28-30(24)22-9-3-2-4-10-22/h2-4,9-14,18-19H,5-8,15-17H2,1H3,(H,27,31)/p+1/t19-/m0/s1 |
| InChIKey | JSIVQULMHAIBJE-IBGZPJMESA-O |
| XLogP | 3.26 |
| TPSA | 51.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|