C27H34N3O+ — CID 4519108
2-(3,4-dimethylphenyl)-N-[3-(2-methylpiperidin-1-ium-1-yl)propyl]quinoline-4-carboxamide (PubChem CID 4519108) has the molecular formula C27H34N3O+ and a molecular weight of 416.59 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-N-[3-(2-methylpiperidin-1-ium-1-yl)propyl]quinoline-4-carboxamide.
| Compound Name | 2-(3,4-dimethylphenyl)-N-[3-(2-methylpiperidin-1-ium-1-yl)propyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 4519108 |
| Molecular Formula | C27H34N3O+ |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-N-[3-(2-methylpiperidin-1-ium-1-yl)propyl]quinoline-4-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NCCC[NH+]3CCCCC3C)c3ccccc3n2)cc1C |
| InChI | InChI=1S/C27H33N3O/c1-19-12-13-22(17-20(19)2)26-18-24(23-10-4-5-11-25(23)29-26)27(31)28-14-8-16-30-15-7-6-9-21(30)3/h4-5,10-13,17-18,21H,6-9,14-16H2,1-3H3,(H,28,31)/p+1 |
| InChIKey | CCFKEMMUIFSRQG-UHFFFAOYSA-O |
| XLogP | 4.10 |
| TPSA | 46.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|