C31H34ClN4O+ — CID 5060544
N-[3-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]propyl]-2-(3,4-dimethylphenyl)quinoline-4-carboxamide (PubChem CID 5060544) has the molecular formula C31H34ClN4O+ and a molecular weight of 514.09 g/mol. Its IUPAC name is N-[3-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]propyl]-2-(3,4-dimethylphenyl)quinoline-4-carboxamide.
| Compound Name | N-[3-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]propyl]-2-(3,4-dimethylphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 5060544 |
| Molecular Formula | C31H34ClN4O+ |
| Molecular Weight | 514.09 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | N-[3-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]propyl]-2-(3,4-dimethylphenyl)quinoline-4-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NCCC[NH+]3CCN(c4cccc(Cl)c4)CC3)c3ccccc3n2)cc1C |
| InChI | InChI=1S/C31H33ClN4O/c1-22-11-12-24(19-23(22)2)30-21-28(27-9-3-4-10-29(27)34-30)31(37)33-13-6-14-35-15-17-36(18-16-35)26-8-5-7-25(32)20-26/h3-5,7-12,19-21H,6,13-18H2,1-2H3,(H,33,37)/p+1 |
| InChIKey | URSPLJKDTOLNLB-UHFFFAOYSA-O |
| XLogP | 4.70 |
| TPSA | 49.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.09 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|