C24H32N5O+ — CID 7328047
N-[3-[(2R)-2-methylpiperidin-1-ium-1-yl]propyl]-3-(1-methylpyrrol-2-yl)-1-phenylpyrazole-5-carboxamide (PubChem CID 7328047) has the molecular formula C24H32N5O+ and a molecular weight of 406.55 g/mol. Its IUPAC name is N-[3-[(2R)-2-methylpiperidin-1-ium-1-yl]propyl]-3-(1-methylpyrrol-2-yl)-1-phenylpyrazole-5-carboxamide.
| Compound Name | N-[3-[(2R)-2-methylpiperidin-1-ium-1-yl]propyl]-3-(1-methylpyrrol-2-yl)-1-phenylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 7328047 |
| Molecular Formula | C24H32N5O+ |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | N-[3-[(2R)-2-methylpiperidin-1-ium-1-yl]propyl]-3-(1-methylpyrrol-2-yl)-1-phenylpyrazole-5-carboxamide |
| SMILES | C[C@@H]1CCCC[NH+]1CCCNC(=O)c1cc(-c2cccn2C)nn1-c1ccccc1 |
| InChI | InChI=1S/C24H31N5O/c1-19-10-6-7-16-28(19)17-9-14-25-24(30)23-18-21(22-13-8-15-27(22)2)26-29(23)20-11-4-3-5-12-20/h3-5,8,11-13,15,18-19H,6-7,9-10,14,16-17H2,1-2H3,(H,25,30)/p+1/t19-/m1/s1 |
| InChIKey | XAGMQBCTKHPQSO-LJQANCHMSA-O |
| XLogP | 2.45 |
| TPSA | 56.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|