C19H25N3O — CID 9268507
N-cycloheptyl-3,5-dimethyl-1-phenylpyrazole-4-carboxamide (PubChem CID 9268507) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is N-cycloheptyl-3,5-dimethyl-1-phenylpyrazole-4-carboxamide.
| Compound Name | N-cycloheptyl-3,5-dimethyl-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 9268507 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | N-cycloheptyl-3,5-dimethyl-1-phenylpyrazole-4-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C19H25N3O/c1-14-18(19(23)20-16-10-6-3-4-7-11-16)15(2)22(21-14)17-12-8-5-9-13-17/h5,8-9,12-13,16H,3-4,6-7,10-11H2,1-2H3,(H,20,23) |
| InChIKey | GUXCJVLCBSKRCZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |