C15H18N4O — CID 42880791
N-cyclohexyl-1-phenyl-1,2,4-triazole-3-carboxamide (PubChem CID 42880791) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is N-cyclohexyl-1-phenyl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-cyclohexyl-1-phenyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 42880791 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | N-cyclohexyl-1-phenyl-1,2,4-triazole-3-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1ncn(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H18N4O/c20-15(17-12-7-3-1-4-8-12)14-16-11-19(18-14)13-9-5-2-6-10-13/h2,5-6,9-12H,1,3-4,7-8H2,(H,17,20) |
| InChIKey | QINJORZQJDAEGJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |