C21H23N5O — CID 42692501
N-(1-benzylpiperidin-4-yl)-1-phenyl-1,2,4-triazole-3-carboxamide (PubChem CID 42692501) has the molecular formula C21H23N5O and a molecular weight of 361.45 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-1-phenyl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-1-phenyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 42692501 |
| Molecular Formula | C21H23N5O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-1-phenyl-1,2,4-triazole-3-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccccc2)CC1)c1ncn(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H23N5O/c27-21(20-22-16-26(24-20)19-9-5-2-6-10-19)23-18-11-13-25(14-12-18)15-17-7-3-1-4-8-17/h1-10,16,18H,11-15H2,(H,23,27) |
| InChIKey | QOCOBTSNRDBOFQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |