C19H26N4O — CID 110747761
1-cyclopentyl-3-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)ethyl]urea (PubChem CID 110747761) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is 1-cyclopentyl-3-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)ethyl]urea.
| Compound Name | 1-cyclopentyl-3-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 110747761 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 1-cyclopentyl-3-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)ethyl]urea |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1CCNC(=O)NC1CCCC1 |
| InChI | InChI=1S/C19H26N4O/c1-14-18(12-13-20-19(24)21-16-8-6-7-9-16)15(2)23(22-14)17-10-4-3-5-11-17/h3-5,10-11,16H,6-9,12-13H2,1-2H3,(H2,20,21,24) |
| InChIKey | WDMPHFNGGZSMAA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |