C18H25N3O — CID 110717337
N-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)ethyl]pentanamide (PubChem CID 110717337) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is N-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)ethyl]pentanamide.
| Compound Name | N-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)ethyl]pentanamide |
|---|---|
| PubChem CID | 110717337 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | N-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)ethyl]pentanamide |
| SMILES | CCCCC(=O)NCCc1c(C)nn(-c2ccccc2)c1C |
| InChI | InChI=1S/C18H25N3O/c1-4-5-11-18(22)19-13-12-17-14(2)20-21(15(17)3)16-9-7-6-8-10-16/h6-10H,4-5,11-13H2,1-3H3,(H,19,22) |
| InChIKey | GOLBGKYIJFWSJG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |