About N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-methylhexanamide
N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-methylhexanamide (PubChem CID 60521825) has the molecular formula C19H27N3O
and a molecular weight of 313.44 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-methylhexanamide.
Molecular Properties
| Compound Name | N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-methylhexanamide |
| PubChem CID | 60521825 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-methylhexanamide |
| SMILES | CCCCCC(=O)N(C)Cc1c(C)nn(-c2ccccc2)c1C |
| InChI | InChI=1S/C19H27N3O/c1-5-6-8-13-19(23)21(4)14-18-15(2)20-22(16(18)3)17-11-9-7-10-12-17/h7,9-12H,5-6,8,13-14H2,1-4H3 |
| InChIKey | CUNMLUSWRNBWBN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-methylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-methylhexanamide?
The IUPAC name of N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-methylhexanamide (CID 60521825) is N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-methylhexanamide.
What is the SMILES notation for N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-methylhexanamide?
The canonical SMILES for N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-methylhexanamide is CCCCCC(=O)N(C)Cc1c(C)nn(-c2ccccc2)c1C.
What is the InChIKey of N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-methylhexanamide?
The InChIKey is CUNMLUSWRNBWBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27N3O/c1-5-6-8-13-19(23)21(4)14-18-15(2)20-22(16(18)3)17-11-9-7-10-12-17/h7,9-12H,5-6,8,13-14H2,1-4H3.
What are the key properties of N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-methylhexanamide?
N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-methylhexanamide has a molecular weight of 313.44 g/mol, XLogP of 4.03, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-methylhexanamide is sourced from PubChem (CID 60521825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).