C19H27N3O — CID 60521825
N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-methylhexanamide (PubChem CID 60521825) has the molecular formula C19H27N3O and a molecular weight of 313.44 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-methylhexanamide.
| Compound Name | N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-methylhexanamide |
|---|---|
| PubChem CID | 60521825 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-methylhexanamide |
| SMILES | CCCCCC(=O)N(C)Cc1c(C)nn(-c2ccccc2)c1C |
| InChI | InChI=1S/C19H27N3O/c1-5-6-8-13-19(23)21(4)14-18-15(2)20-22(16(18)3)17-11-9-7-10-12-17/h7,9-12H,5-6,8,13-14H2,1-4H3 |
| InChIKey | CUNMLUSWRNBWBN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|