C19H23N5O3 — CID 40797001
N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-3-[(4R)-2,5-dioxoimidazolidin-4-yl]-N-methylpropanamide (PubChem CID 40797001) has the molecular formula C19H23N5O3 and a molecular weight of 369.43 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-3-[(4R)-2,5-dioxoimidazolidin-4-yl]-N-methylpropanamide.
| Compound Name | N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-3-[(4R)-2,5-dioxoimidazolidin-4-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 40797001 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-3-[(4R)-2,5-dioxoimidazolidin-4-yl]-N-methylpropanamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1CN(C)C(=O)CC[C@H]1NC(=O)NC1=O |
| InChI | InChI=1S/C19H23N5O3/c1-12-15(13(2)24(22-12)14-7-5-4-6-8-14)11-23(3)17(25)10-9-16-18(26)21-19(27)20-16/h4-8,16H,9-11H2,1-3H3,(H2,20,21,26,27)/t16-/m1/s1 |
| InChIKey | LHLKDJXGRMWJPF-MRXNPFEDSA-N |
| XLogP | 1.44 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|