C17H18N4O3S — CID 95875737
3-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-methyl-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]propanamide (PubChem CID 95875737) has the molecular formula C17H18N4O3S and a molecular weight of 358.42 g/mol. Its IUPAC name is 3-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-methyl-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]propanamide.
| Compound Name | 3-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-methyl-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]propanamide |
|---|---|
| PubChem CID | 95875737 |
| Molecular Formula | C17H18N4O3S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 3-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-methyl-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]propanamide |
| SMILES | CN(Cc1csc(-c2ccccc2)n1)C(=O)CC[C@@H]1NC(=O)NC1=O |
| InChI | InChI=1S/C17H18N4O3S/c1-21(14(22)8-7-13-15(23)20-17(24)19-13)9-12-10-25-16(18-12)11-5-3-2-4-6-11/h2-6,10,13H,7-9H2,1H3,(H2,19,20,23,24)/t13-/m0/s1 |
| InChIKey | OWVWRPWNWSYLET-ZDUSSCGKSA-N |
| XLogP | 1.76 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|