C16H16N4O4 — CID 95875059
2-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-methyl-N-[(3-phenyl-1,2-oxazol-5-yl)methyl]acetamide (PubChem CID 95875059) has the molecular formula C16H16N4O4 and a molecular weight of 328.33 g/mol. Its IUPAC name is 2-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-methyl-N-[(3-phenyl-1,2-oxazol-5-yl)methyl]acetamide.
| Compound Name | 2-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-methyl-N-[(3-phenyl-1,2-oxazol-5-yl)methyl]acetamide |
|---|---|
| PubChem CID | 95875059 |
| Molecular Formula | C16H16N4O4 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-methyl-N-[(3-phenyl-1,2-oxazol-5-yl)methyl]acetamide |
| SMILES | CN(Cc1cc(-c2ccccc2)no1)C(=O)C[C@@H]1NC(=O)NC1=O |
| InChI | InChI=1S/C16H16N4O4/c1-20(14(21)8-13-15(22)18-16(23)17-13)9-11-7-12(19-24-11)10-5-3-2-4-6-10/h2-7,13H,8-9H2,1H3,(H2,17,18,22,23)/t13-/m0/s1 |
| InChIKey | ZSMXXLNVMAYKPA-ZDUSSCGKSA-N |
| XLogP | 0.90 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|