C15H14ClN3O3S — CID 95221460
N-[(3-chloro-1-benzothiophen-2-yl)methyl]-2-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-methylacetamide (PubChem CID 95221460) has the molecular formula C15H14ClN3O3S and a molecular weight of 351.82 g/mol. Its IUPAC name is N-[(3-chloro-1-benzothiophen-2-yl)methyl]-2-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-methylacetamide.
| Compound Name | N-[(3-chloro-1-benzothiophen-2-yl)methyl]-2-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 95221460 |
| Molecular Formula | C15H14ClN3O3S |
| Molecular Weight | 351.82 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | N-[(3-chloro-1-benzothiophen-2-yl)methyl]-2-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-methylacetamide |
| SMILES | CN(Cc1sc2ccccc2c1Cl)C(=O)C[C@@H]1NC(=O)NC1=O |
| InChI | InChI=1S/C15H14ClN3O3S/c1-19(12(20)6-9-14(21)18-15(22)17-9)7-11-13(16)8-4-2-3-5-10(8)23-11/h2-5,9H,6-7H2,1H3,(H2,17,18,21,22)/t9-/m0/s1 |
| InChIKey | LEKIOWCQLDMJIH-VIFPVBQESA-N |
| XLogP | 2.11 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.82 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|