C15H16ClNO2S — CID 56753523
(2R)-N-[(3-chloro-1-benzothiophen-2-yl)methyl]-N-methyloxolane-2-carboxamide (PubChem CID 56753523) has the molecular formula C15H16ClNO2S and a molecular weight of 309.82 g/mol. Its IUPAC name is (2R)-N-[(3-chloro-1-benzothiophen-2-yl)methyl]-N-methyloxolane-2-carboxamide.
| Compound Name | (2R)-N-[(3-chloro-1-benzothiophen-2-yl)methyl]-N-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 56753523 |
| Molecular Formula | C15H16ClNO2S |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | (2R)-N-[(3-chloro-1-benzothiophen-2-yl)methyl]-N-methyloxolane-2-carboxamide |
| SMILES | CN(Cc1sc2ccccc2c1Cl)C(=O)[C@H]1CCCO1 |
| InChI | InChI=1S/C15H16ClNO2S/c1-17(15(18)11-6-4-8-19-11)9-13-14(16)10-5-2-3-7-12(10)20-13/h2-3,5,7,11H,4,6,8-9H2,1H3/t11-/m1/s1 |
| InChIKey | RXPJWUYRPBPSOR-LLVKDONJSA-N |
| XLogP | 3.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |