C15H18ClNO2S — CID 62012509
methyl 4-[(3-chloro-1-benzothiophen-2-yl)methyl-methylamino]butanoate (PubChem CID 62012509) has the molecular formula C15H18ClNO2S and a molecular weight of 311.83 g/mol. Its IUPAC name is methyl 4-[(3-chloro-1-benzothiophen-2-yl)methyl-methylamino]butanoate.
| Compound Name | methyl 4-[(3-chloro-1-benzothiophen-2-yl)methyl-methylamino]butanoate |
|---|---|
| PubChem CID | 62012509 |
| Molecular Formula | C15H18ClNO2S |
| Molecular Weight | 311.83 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | methyl 4-[(3-chloro-1-benzothiophen-2-yl)methyl-methylamino]butanoate |
| SMILES | COC(=O)CCCN(C)Cc1sc2ccccc2c1Cl |
| InChI | InChI=1S/C15H18ClNO2S/c1-17(9-5-8-14(18)19-2)10-13-15(16)11-6-3-4-7-12(11)20-13/h3-4,6-7H,5,8-10H2,1-2H3 |
| InChIKey | ROWAANMIEUKAIV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.83 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |