C13H17ClFNO2 — CID 112654069
methyl 4-[(2-chloro-3-fluorophenyl)methyl-methylamino]butanoate (PubChem CID 112654069) has the molecular formula C13H17ClFNO2 and a molecular weight of 273.73 g/mol. Its IUPAC name is methyl 4-[(2-chloro-3-fluorophenyl)methyl-methylamino]butanoate.
| Compound Name | methyl 4-[(2-chloro-3-fluorophenyl)methyl-methylamino]butanoate |
|---|---|
| PubChem CID | 112654069 |
| Molecular Formula | C13H17ClFNO2 |
| Molecular Weight | 273.73 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | methyl 4-[(2-chloro-3-fluorophenyl)methyl-methylamino]butanoate |
| SMILES | COC(=O)CCCN(C)Cc1cccc(F)c1Cl |
| InChI | InChI=1S/C13H17ClFNO2/c1-16(8-4-7-12(17)18-2)9-10-5-3-6-11(15)13(10)14/h3,5-6H,4,7-9H2,1-2H3 |
| InChIKey | TWTUWXUAYQRWPS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.73 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |