C15H15N5O4 — CID 77082164
2-(2,5-dioxoimidazolidin-4-yl)-N-[2-(5-phenyl-1,2,4-oxadiazol-3-yl)ethyl]acetamide (PubChem CID 77082164) has the molecular formula C15H15N5O4 and a molecular weight of 329.32 g/mol. Its IUPAC name is 2-(2,5-dioxoimidazolidin-4-yl)-N-[2-(5-phenyl-1,2,4-oxadiazol-3-yl)ethyl]acetamide.
| Compound Name | 2-(2,5-dioxoimidazolidin-4-yl)-N-[2-(5-phenyl-1,2,4-oxadiazol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 77082164 |
| Molecular Formula | C15H15N5O4 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 2-(2,5-dioxoimidazolidin-4-yl)-N-[2-(5-phenyl-1,2,4-oxadiazol-3-yl)ethyl]acetamide |
| SMILES | O=C(CC1NC(=O)NC1=O)NCCc1noc(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H15N5O4/c21-12(8-10-13(22)19-15(23)17-10)16-7-6-11-18-14(24-20-11)9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,16,21)(H2,17,19,22,23) |
| InChIKey | IGGVHHJVJHNGJK-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 126.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|