C15H16N6O3 — CID 99937211
2-[(4R)-2,5-dioxoimidazolidin-4-yl]-N-[2-(3-phenyl-1H-1,2,4-triazol-5-yl)ethyl]acetamide (PubChem CID 99937211) has the molecular formula C15H16N6O3 and a molecular weight of 328.33 g/mol. Its IUPAC name is 2-[(4R)-2,5-dioxoimidazolidin-4-yl]-N-[2-(3-phenyl-1H-1,2,4-triazol-5-yl)ethyl]acetamide.
| Compound Name | 2-[(4R)-2,5-dioxoimidazolidin-4-yl]-N-[2-(3-phenyl-1H-1,2,4-triazol-5-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 99937211 |
| Molecular Formula | C15H16N6O3 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 2-[(4R)-2,5-dioxoimidazolidin-4-yl]-N-[2-(3-phenyl-1H-1,2,4-triazol-5-yl)ethyl]acetamide |
| SMILES | O=C(C[C@H]1NC(=O)NC1=O)NCCc1nc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C15H16N6O3/c22-12(8-10-14(23)19-15(24)17-10)16-7-6-11-18-13(21-20-11)9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,16,22)(H,18,20,21)(H2,17,19,23,24)/t10-/m1/s1 |
| InChIKey | SSRPIOBTEGJDFW-SNVBAGLBSA-N |
| XLogP | -0.27 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|