C21H21FN6O2 — CID 55864296
1-(4-fluorophenyl)-3,5-dimethyl-N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]pyrazole-4-carboxamide (PubChem CID 55864296) has the molecular formula C21H21FN6O2 and a molecular weight of 408.44 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3,5-dimethyl-N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]pyrazole-4-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-3,5-dimethyl-N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55864296 |
| Molecular Formula | C21H21FN6O2 |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 1-(4-fluorophenyl)-3,5-dimethyl-N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]pyrazole-4-carboxamide |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(C)c1C(=O)NCCCn1nc2ccccn2c1=O |
| InChI | InChI=1S/C21H21FN6O2/c1-14-19(15(2)28(24-14)17-9-7-16(22)8-10-17)20(29)23-11-5-13-27-21(30)26-12-4-3-6-18(26)25-27/h3-4,6-10,12H,5,11,13H2,1-2H3,(H,23,29) |
| InChIKey | HYYVHQFEVGNJIA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|