C19H17FN6O2 — CID 47893685
1-(3-fluorophenyl)-N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]pyrazole-3-carboxamide (PubChem CID 47893685) has the molecular formula C19H17FN6O2 and a molecular weight of 380.38 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]pyrazole-3-carboxamide.
| Compound Name | 1-(3-fluorophenyl)-N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 47893685 |
| Molecular Formula | C19H17FN6O2 |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 1-(3-fluorophenyl)-N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]pyrazole-3-carboxamide |
| SMILES | O=C(NCCCn1nc2ccccn2c1=O)c1ccn(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C19H17FN6O2/c20-14-5-3-6-15(13-14)25-12-8-16(22-25)18(27)21-9-4-11-26-19(28)24-10-2-1-7-17(24)23-26/h1-3,5-8,10,12-13H,4,9,11H2,(H,21,27) |
| InChIKey | RMAZACCFQNXFDA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|