C17H21FN4O — CID 47855978
1-(3-fluorophenyl)-N-(2-piperidin-1-ylethyl)pyrazole-3-carboxamide (PubChem CID 47855978) has the molecular formula C17H21FN4O and a molecular weight of 316.38 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N-(2-piperidin-1-ylethyl)pyrazole-3-carboxamide.
| Compound Name | 1-(3-fluorophenyl)-N-(2-piperidin-1-ylethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 47855978 |
| Molecular Formula | C17H21FN4O |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 1-(3-fluorophenyl)-N-(2-piperidin-1-ylethyl)pyrazole-3-carboxamide |
| SMILES | O=C(NCCN1CCCCC1)c1ccn(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C17H21FN4O/c18-14-5-4-6-15(13-14)22-11-7-16(20-22)17(23)19-8-12-21-9-2-1-3-10-21/h4-7,11,13H,1-3,8-10,12H2,(H,19,23) |
| InChIKey | PDSFUGNLJDBSEE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |