C19H23FN4O2S — CID 47887090
1-(3-fluorophenyl)-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]pyrazole-3-carboxamide (PubChem CID 47887090) has the molecular formula C19H23FN4O2S and a molecular weight of 390.48 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]pyrazole-3-carboxamide.
| Compound Name | 1-(3-fluorophenyl)-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 47887090 |
| Molecular Formula | C19H23FN4O2S |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 1-(3-fluorophenyl)-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]pyrazole-3-carboxamide |
| SMILES | O=C(NCC1(N2CCOCC2)CCSC1)c1ccn(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C19H23FN4O2S/c20-15-2-1-3-16(12-15)24-6-4-17(22-24)18(25)21-13-19(5-11-27-14-19)23-7-9-26-10-8-23/h1-4,6,12H,5,7-11,13-14H2,(H,21,25) |
| InChIKey | NBRXLIKUIJLYKL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |