C17H23FN2O2S — CID 139028683
2-fluoro-N-[(4-morpholin-4-ylthian-4-yl)methyl]benzamide (PubChem CID 139028683) has the molecular formula C17H23FN2O2S and a molecular weight of 338.45 g/mol. Its IUPAC name is 2-fluoro-N-[(4-morpholin-4-ylthian-4-yl)methyl]benzamide.
| Compound Name | 2-fluoro-N-[(4-morpholin-4-ylthian-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 139028683 |
| Molecular Formula | C17H23FN2O2S |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 2-fluoro-N-[(4-morpholin-4-ylthian-4-yl)methyl]benzamide |
| SMILES | O=C(NCC1(N2CCOCC2)CCSCC1)c1ccccc1F |
| InChI | InChI=1S/C17H23FN2O2S/c18-15-4-2-1-3-14(15)16(21)19-13-17(5-11-23-12-6-17)20-7-9-22-10-8-20/h1-4H,5-13H2,(H,19,21) |
| InChIKey | ZBUGCPZPYZIEBQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |