C16H20F2N2O2S — CID 94667443
2,6-difluoro-N-[[(3S)-3-morpholin-4-ylthiolan-3-yl]methyl]benzamide (PubChem CID 94667443) has the molecular formula C16H20F2N2O2S and a molecular weight of 342.41 g/mol. Its IUPAC name is 2,6-difluoro-N-[[(3S)-3-morpholin-4-ylthiolan-3-yl]methyl]benzamide.
| Compound Name | 2,6-difluoro-N-[[(3S)-3-morpholin-4-ylthiolan-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 94667443 |
| Molecular Formula | C16H20F2N2O2S |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2,6-difluoro-N-[[(3S)-3-morpholin-4-ylthiolan-3-yl]methyl]benzamide |
| SMILES | O=C(NC[C@@]1(N2CCOCC2)CCSC1)c1c(F)cccc1F |
| InChI | InChI=1S/C16H20F2N2O2S/c17-12-2-1-3-13(18)14(12)15(21)19-10-16(4-9-23-11-16)20-5-7-22-8-6-20/h1-3H,4-11H2,(H,19,21)/t16-/m0/s1 |
| InChIKey | FWGRUYGTLDINKX-INIZCTEOSA-N |
| XLogP | 1.90 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |