C15H22N4O2S — CID 39155566
5-methyl-N-[[(3S)-3-morpholin-4-ylthiolan-3-yl]methyl]pyrazine-2-carboxamide (PubChem CID 39155566) has the molecular formula C15H22N4O2S and a molecular weight of 322.43 g/mol. Its IUPAC name is 5-methyl-N-[[(3S)-3-morpholin-4-ylthiolan-3-yl]methyl]pyrazine-2-carboxamide.
| Compound Name | 5-methyl-N-[[(3S)-3-morpholin-4-ylthiolan-3-yl]methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 39155566 |
| Molecular Formula | C15H22N4O2S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 5-methyl-N-[[(3S)-3-morpholin-4-ylthiolan-3-yl]methyl]pyrazine-2-carboxamide |
| SMILES | Cc1cnc(C(=O)NC[C@@]2(N3CCOCC3)CCSC2)cn1 |
| InChI | InChI=1S/C15H22N4O2S/c1-12-8-17-13(9-16-12)14(20)18-10-15(2-7-22-11-15)19-3-5-21-6-4-19/h8-9H,2-7,10-11H2,1H3,(H,18,20)/t15-/m0/s1 |
| InChIKey | MWMFBCBBYUNGHO-HNNXBMFYSA-N |
| XLogP | 0.72 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |