C18H27N3O4S — CID 55696410
1-(3,5-dimethoxyphenyl)-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]urea (PubChem CID 55696410) has the molecular formula C18H27N3O4S and a molecular weight of 381.50 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]urea.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]urea |
|---|---|
| PubChem CID | 55696410 |
| Molecular Formula | C18H27N3O4S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]urea |
| SMILES | COc1cc(NC(=O)NCC2(N3CCOCC3)CCSC2)cc(OC)c1 |
| InChI | InChI=1S/C18H27N3O4S/c1-23-15-9-14(10-16(11-15)24-2)20-17(22)19-12-18(3-8-26-13-18)21-4-6-25-7-5-21/h9-11H,3-8,12-13H2,1-2H3,(H2,19,20,22) |
| InChIKey | KKLAQAQAQNZDNV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |