C23H34N4O3S — CID 55833645
1-[4-(azepane-1-carbonyl)phenyl]-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]urea (PubChem CID 55833645) has the molecular formula C23H34N4O3S and a molecular weight of 446.62 g/mol. Its IUPAC name is 1-[4-(azepane-1-carbonyl)phenyl]-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]urea.
| Compound Name | 1-[4-(azepane-1-carbonyl)phenyl]-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]urea |
|---|---|
| PubChem CID | 55833645 |
| Molecular Formula | C23H34N4O3S |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | 1-[4-(azepane-1-carbonyl)phenyl]-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]urea |
| SMILES | O=C(NCC1(N2CCOCC2)CCSC1)Nc1ccc(C(=O)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C23H34N4O3S/c28-21(26-10-3-1-2-4-11-26)19-5-7-20(8-6-19)25-22(29)24-17-23(9-16-31-18-23)27-12-14-30-15-13-27/h5-8H,1-4,9-18H2,(H2,24,25,29) |
| InChIKey | JBWYEQYDGYGLHB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |