C18H25N3O3S — CID 55696476
1-(3-acetylphenyl)-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]urea (PubChem CID 55696476) has the molecular formula C18H25N3O3S and a molecular weight of 363.48 g/mol. Its IUPAC name is 1-(3-acetylphenyl)-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]urea.
| Compound Name | 1-(3-acetylphenyl)-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]urea |
|---|---|
| PubChem CID | 55696476 |
| Molecular Formula | C18H25N3O3S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 1-(3-acetylphenyl)-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]urea |
| SMILES | CC(=O)c1cccc(NC(=O)NCC2(N3CCOCC3)CCSC2)c1 |
| InChI | InChI=1S/C18H25N3O3S/c1-14(22)15-3-2-4-16(11-15)20-17(23)19-12-18(5-10-25-13-18)21-6-8-24-9-7-21/h2-4,11H,5-10,12-13H2,1H3,(H2,19,20,23) |
| InChIKey | YOEOVMMTEBEDLM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |