C20H34N4O2S — CID 47056037
1-tert-butyl-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]-5-propan-2-ylpyrazole-3-carboxamide (PubChem CID 47056037) has the molecular formula C20H34N4O2S and a molecular weight of 394.59 g/mol. Its IUPAC name is 1-tert-butyl-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]-5-propan-2-ylpyrazole-3-carboxamide.
| Compound Name | 1-tert-butyl-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]-5-propan-2-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 47056037 |
| Molecular Formula | C20H34N4O2S |
| Molecular Weight | 394.59 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 1-tert-butyl-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]-5-propan-2-ylpyrazole-3-carboxamide |
| SMILES | CC(C)c1cc(C(=O)NCC2(N3CCOCC3)CCSC2)nn1C(C)(C)C |
| InChI | InChI=1S/C20H34N4O2S/c1-15(2)17-12-16(22-24(17)19(3,4)5)18(25)21-13-20(6-11-27-14-20)23-7-9-26-10-8-23/h12,15H,6-11,13-14H2,1-5H3,(H,21,25) |
| InChIKey | JNUHEBRLSFPNPK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.59 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |