C13H27Cl2N3O2S — CID 119862806
3-amino-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]butanamide;dihydrochloride (PubChem CID 119862806) has the molecular formula C13H27Cl2N3O2S and a molecular weight of 360.35 g/mol. Its IUPAC name is 3-amino-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]butanamide;dihydrochloride.
| Compound Name | 3-amino-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119862806 |
| Molecular Formula | C13H27Cl2N3O2S |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 3-amino-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]butanamide;dihydrochloride |
| SMILES | CC(N)CC(=O)NCC1(N2CCOCC2)CCSC1.Cl.Cl |
| InChI | InChI=1S/C13H25N3O2S.2ClH/c1-11(14)8-12(17)15-9-13(2-7-19-10-13)16-3-5-18-6-4-16;;/h11H,2-10,14H2,1H3,(H,15,17);2*1H |
| InChIKey | HUWXIPFWWOTCQX-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |