C18H33N3O2S — CID 119862801
N-[(3-morpholin-4-ylthiolan-3-yl)methyl]-3-piperidin-4-ylbutanamide (PubChem CID 119862801) has the molecular formula C18H33N3O2S and a molecular weight of 355.55 g/mol. Its IUPAC name is N-[(3-morpholin-4-ylthiolan-3-yl)methyl]-3-piperidin-4-ylbutanamide.
| Compound Name | N-[(3-morpholin-4-ylthiolan-3-yl)methyl]-3-piperidin-4-ylbutanamide |
|---|---|
| PubChem CID | 119862801 |
| Molecular Formula | C18H33N3O2S |
| Molecular Weight | 355.55 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | N-[(3-morpholin-4-ylthiolan-3-yl)methyl]-3-piperidin-4-ylbutanamide |
| SMILES | CC(CC(=O)NCC1(N2CCOCC2)CCSC1)C1CCNCC1 |
| InChI | InChI=1S/C18H33N3O2S/c1-15(16-2-5-19-6-3-16)12-17(22)20-13-18(4-11-24-14-18)21-7-9-23-10-8-21/h15-16,19H,2-14H2,1H3,(H,20,22) |
| InChIKey | WHKZTARCWJCSGZ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.55 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |