C15H27N3O3S — CID 95158483
1-[[(3S)-3-morpholin-4-ylthiolan-3-yl]methyl]-3-[[(3R)-oxolan-3-yl]methyl]urea (PubChem CID 95158483) has the molecular formula C15H27N3O3S and a molecular weight of 329.47 g/mol. Its IUPAC name is 1-[[(3S)-3-morpholin-4-ylthiolan-3-yl]methyl]-3-[[(3R)-oxolan-3-yl]methyl]urea.
| Compound Name | 1-[[(3S)-3-morpholin-4-ylthiolan-3-yl]methyl]-3-[[(3R)-oxolan-3-yl]methyl]urea |
|---|---|
| PubChem CID | 95158483 |
| Molecular Formula | C15H27N3O3S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | 1-[[(3S)-3-morpholin-4-ylthiolan-3-yl]methyl]-3-[[(3R)-oxolan-3-yl]methyl]urea |
| SMILES | O=C(NC[C@H]1CCOC1)NC[C@@]1(N2CCOCC2)CCSC1 |
| InChI | InChI=1S/C15H27N3O3S/c19-14(16-9-13-1-5-21-10-13)17-11-15(2-8-22-12-15)18-3-6-20-7-4-18/h13H,1-12H2,(H2,16,17,19)/t13-,15+/m1/s1 |
| InChIKey | VBPXSUUTKLHBMB-HIFRSBDPSA-N |
| XLogP | 0.53 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |