C21H40ClN3O — CID 119682326
3-piperidin-4-yl-N-[(1-piperidin-1-ylcyclohexyl)methyl]butanamide;hydrochloride (PubChem CID 119682326) has the molecular formula C21H40ClN3O and a molecular weight of 386.02 g/mol. Its IUPAC name is 3-piperidin-4-yl-N-[(1-piperidin-1-ylcyclohexyl)methyl]butanamide;hydrochloride.
| Compound Name | 3-piperidin-4-yl-N-[(1-piperidin-1-ylcyclohexyl)methyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119682326 |
| Molecular Formula | C21H40ClN3O |
| Molecular Weight | 386.02 g/mol |
| Exact Mass | 385.29 |
| IUPAC Name | 3-piperidin-4-yl-N-[(1-piperidin-1-ylcyclohexyl)methyl]butanamide;hydrochloride |
| SMILES | CC(CC(=O)NCC1(N2CCCCC2)CCCCC1)C1CCNCC1.Cl |
| InChI | InChI=1S/C21H39N3O.ClH/c1-18(19-8-12-22-13-9-19)16-20(25)23-17-21(10-4-2-5-11-21)24-14-6-3-7-15-24;/h18-19,22H,2-17H2,1H3,(H,23,25);1H |
| InChIKey | NNRRQLCJJCZLGZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.02 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |