C19H28Cl2N2O — CID 119772684
N-[[1-(4-chlorophenyl)cyclopropyl]methyl]-3-piperidin-4-ylbutanamide;hydrochloride (PubChem CID 119772684) has the molecular formula C19H28Cl2N2O and a molecular weight of 371.35 g/mol. Its IUPAC name is N-[[1-(4-chlorophenyl)cyclopropyl]methyl]-3-piperidin-4-ylbutanamide;hydrochloride.
| Compound Name | N-[[1-(4-chlorophenyl)cyclopropyl]methyl]-3-piperidin-4-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119772684 |
| Molecular Formula | C19H28Cl2N2O |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | N-[[1-(4-chlorophenyl)cyclopropyl]methyl]-3-piperidin-4-ylbutanamide;hydrochloride |
| SMILES | CC(CC(=O)NCC1(c2ccc(Cl)cc2)CC1)C1CCNCC1.Cl |
| InChI | InChI=1S/C19H27ClN2O.ClH/c1-14(15-6-10-21-11-7-15)12-18(23)22-13-19(8-9-19)16-2-4-17(20)5-3-16;/h2-5,14-15,21H,6-13H2,1H3,(H,22,23);1H |
| InChIKey | ALGJDPAPGDPDCZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |