C19H28ClN3O2 — CID 119738720
N-[4-(4-chloroanilino)-4-oxobutyl]-3-piperidin-4-ylbutanamide (PubChem CID 119738720) has the molecular formula C19H28ClN3O2 and a molecular weight of 365.91 g/mol. Its IUPAC name is N-[4-(4-chloroanilino)-4-oxobutyl]-3-piperidin-4-ylbutanamide.
| Compound Name | N-[4-(4-chloroanilino)-4-oxobutyl]-3-piperidin-4-ylbutanamide |
|---|---|
| PubChem CID | 119738720 |
| Molecular Formula | C19H28ClN3O2 |
| Molecular Weight | 365.91 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | N-[4-(4-chloroanilino)-4-oxobutyl]-3-piperidin-4-ylbutanamide |
| SMILES | CC(CC(=O)NCCCC(=O)Nc1ccc(Cl)cc1)C1CCNCC1 |
| InChI | InChI=1S/C19H28ClN3O2/c1-14(15-8-11-21-12-9-15)13-19(25)22-10-2-3-18(24)23-17-6-4-16(20)5-7-17/h4-7,14-15,21H,2-3,8-13H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | NSLKQUFYOCWEMI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.91 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|