C18H27Cl3N2O — CID 119813601
N-[3-(2,4-dichlorophenyl)propyl]-3-piperidin-4-ylbutanamide;hydrochloride (PubChem CID 119813601) has the molecular formula C18H27Cl3N2O and a molecular weight of 393.79 g/mol. Its IUPAC name is N-[3-(2,4-dichlorophenyl)propyl]-3-piperidin-4-ylbutanamide;hydrochloride.
| Compound Name | N-[3-(2,4-dichlorophenyl)propyl]-3-piperidin-4-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119813601 |
| Molecular Formula | C18H27Cl3N2O |
| Molecular Weight | 393.79 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | N-[3-(2,4-dichlorophenyl)propyl]-3-piperidin-4-ylbutanamide;hydrochloride |
| SMILES | CC(CC(=O)NCCCc1ccc(Cl)cc1Cl)C1CCNCC1.Cl |
| InChI | InChI=1S/C18H26Cl2N2O.ClH/c1-13(14-6-9-21-10-7-14)11-18(23)22-8-2-3-15-4-5-16(19)12-17(15)20;/h4-5,12-14,21H,2-3,6-11H2,1H3,(H,22,23);1H |
| InChIKey | QWGQQPSFQLVDQL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.79 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|