C17H27Cl2N3O3S — CID 119704315
N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-piperidin-4-ylbutanamide;hydrochloride (PubChem CID 119704315) has the molecular formula C17H27Cl2N3O3S and a molecular weight of 424.39 g/mol. Its IUPAC name is N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-piperidin-4-ylbutanamide;hydrochloride.
| Compound Name | N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-piperidin-4-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119704315 |
| Molecular Formula | C17H27Cl2N3O3S |
| Molecular Weight | 424.39 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-piperidin-4-ylbutanamide;hydrochloride |
| SMILES | CC(CC(=O)NCCNS(=O)(=O)c1cccc(Cl)c1)C1CCNCC1.Cl |
| InChI | InChI=1S/C17H26ClN3O3S.ClH/c1-13(14-5-7-19-8-6-14)11-17(22)20-9-10-21-25(23,24)16-4-2-3-15(18)12-16;/h2-4,12-14,19,21H,5-11H2,1H3,(H,20,22);1H |
| InChIKey | KNKBMUGWFBNVAZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|