C14H26N2O3 — CID 119684765
methyl 4-(3-piperidin-4-ylbutanoylamino)butanoate (PubChem CID 119684765) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is methyl 4-(3-piperidin-4-ylbutanoylamino)butanoate.
| Compound Name | methyl 4-(3-piperidin-4-ylbutanoylamino)butanoate |
|---|---|
| PubChem CID | 119684765 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | methyl 4-(3-piperidin-4-ylbutanoylamino)butanoate |
| SMILES | COC(=O)CCCNC(=O)CC(C)C1CCNCC1 |
| InChI | InChI=1S/C14H26N2O3/c1-11(12-5-8-15-9-6-12)10-13(17)16-7-3-4-14(18)19-2/h11-12,15H,3-10H2,1-2H3,(H,16,17) |
| InChIKey | ONTGBFKSWHOKDD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|